C17H23N3O2S — CID 96514152
(3S)-1-[2-(benzenesulfonyl)ethyl]-3-(5-methyl-1H-pyrazol-3-yl)piperidine (PubChem CID 96514152) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is (3S)-1-[2-(benzenesulfonyl)ethyl]-3-(5-methyl-1H-pyrazol-3-yl)piperidine.
| Compound Name | (3S)-1-[2-(benzenesulfonyl)ethyl]-3-(5-methyl-1H-pyrazol-3-yl)piperidine |
|---|---|
| PubChem CID | 96514152 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (3S)-1-[2-(benzenesulfonyl)ethyl]-3-(5-methyl-1H-pyrazol-3-yl)piperidine |
| SMILES | Cc1cc([C@H]2CCCN(CCS(=O)(=O)c3ccccc3)C2)n[nH]1 |
| InChI | InChI=1S/C17H23N3O2S/c1-14-12-17(19-18-14)15-6-5-9-20(13-15)10-11-23(21,22)16-7-3-2-4-8-16/h2-4,7-8,12,15H,5-6,9-11,13H2,1H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | UHUYUGFNVSZGNJ-HNNXBMFYSA-N |
| XLogP | 2.37 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |