C17H21N3O3S — CID 97069118
[(3R)-3-(5-methyl-1H-pyrazol-3-yl)piperidin-1-yl]-(4-methylsulfonylphenyl)methanone (PubChem CID 97069118) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is [(3R)-3-(5-methyl-1H-pyrazol-3-yl)piperidin-1-yl]-(4-methylsulfonylphenyl)methanone.
| Compound Name | [(3R)-3-(5-methyl-1H-pyrazol-3-yl)piperidin-1-yl]-(4-methylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 97069118 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [(3R)-3-(5-methyl-1H-pyrazol-3-yl)piperidin-1-yl]-(4-methylsulfonylphenyl)methanone |
| SMILES | Cc1cc([C@@H]2CCCN(C(=O)c3ccc(S(C)(=O)=O)cc3)C2)n[nH]1 |
| InChI | InChI=1S/C17H21N3O3S/c1-12-10-16(19-18-12)14-4-3-9-20(11-14)17(21)13-5-7-15(8-6-13)24(2,22)23/h5-8,10,14H,3-4,9,11H2,1-2H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | IDLSGIJURJALFU-CQSZACIVSA-N |
| XLogP | 2.14 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |