C19H21N5O — CID 146137351
[4-(1H-imidazol-5-yl)phenyl]-[3-(5-methyl-1H-pyrazol-3-yl)piperidin-1-yl]methanone (PubChem CID 146137351) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is [4-(1H-imidazol-5-yl)phenyl]-[3-(5-methyl-1H-pyrazol-3-yl)piperidin-1-yl]methanone.
| Compound Name | [4-(1H-imidazol-5-yl)phenyl]-[3-(5-methyl-1H-pyrazol-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 146137351 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | [4-(1H-imidazol-5-yl)phenyl]-[3-(5-methyl-1H-pyrazol-3-yl)piperidin-1-yl]methanone |
| SMILES | Cc1cc(C2CCCN(C(=O)c3ccc(-c4cnc[nH]4)cc3)C2)n[nH]1 |
| InChI | InChI=1S/C19H21N5O/c1-13-9-17(23-22-13)16-3-2-8-24(11-16)19(25)15-6-4-14(5-7-15)18-10-20-12-21-18/h4-7,9-10,12,16H,2-3,8,11H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | ZZRYNCBANAILGI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |