C15H23N5 — CID 97004575
(3R)-3-(5-methyl-1H-pyrazol-3-yl)-1-[2-(1-methylpyrazol-4-yl)ethyl]piperidine (PubChem CID 97004575) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is (3R)-3-(5-methyl-1H-pyrazol-3-yl)-1-[2-(1-methylpyrazol-4-yl)ethyl]piperidine.
| Compound Name | (3R)-3-(5-methyl-1H-pyrazol-3-yl)-1-[2-(1-methylpyrazol-4-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 97004575 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | (3R)-3-(5-methyl-1H-pyrazol-3-yl)-1-[2-(1-methylpyrazol-4-yl)ethyl]piperidine |
| SMILES | Cc1cc([C@@H]2CCCN(CCc3cnn(C)c3)C2)n[nH]1 |
| InChI | InChI=1S/C15H23N5/c1-12-8-15(18-17-12)14-4-3-6-20(11-14)7-5-13-9-16-19(2)10-13/h8-10,14H,3-7,11H2,1-2H3,(H,17,18)/t14-/m1/s1 |
| InChIKey | ZUZSBHMUKAZTSG-CQSZACIVSA-N |
| XLogP | 1.87 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |