C18H23N5O2 — CID 95780966
(5S)-5-methyl-5-[(3R)-1-[(1-methylbenzimidazol-2-yl)methyl]piperidin-3-yl]imidazolidine-2,4-dione (PubChem CID 95780966) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is (5S)-5-methyl-5-[(3R)-1-[(1-methylbenzimidazol-2-yl)methyl]piperidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-[(3R)-1-[(1-methylbenzimidazol-2-yl)methyl]piperidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95780966 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (5S)-5-methyl-5-[(3R)-1-[(1-methylbenzimidazol-2-yl)methyl]piperidin-3-yl]imidazolidine-2,4-dione |
| SMILES | Cn1c(CN2CCC[C@@H]([C@]3(C)NC(=O)NC3=O)C2)nc2ccccc21 |
| InChI | InChI=1S/C18H23N5O2/c1-18(16(24)20-17(25)21-18)12-6-5-9-23(10-12)11-15-19-13-7-3-4-8-14(13)22(15)2/h3-4,7-8,12H,5-6,9-11H2,1-2H3,(H2,20,21,24,25)/t12-,18+/m1/s1 |
| InChIKey | UNQVBBXOJBDCBE-XIKOKIGWSA-N |
| XLogP | 1.38 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|