C19H24N6 — CID 125024022
3-[[(3S)-1-[(1-methylbenzimidazol-2-yl)methyl]piperidin-3-yl]methyl]pyrazin-2-amine (PubChem CID 125024022) has the molecular formula C19H24N6 and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-[[(3S)-1-[(1-methylbenzimidazol-2-yl)methyl]piperidin-3-yl]methyl]pyrazin-2-amine.
| Compound Name | 3-[[(3S)-1-[(1-methylbenzimidazol-2-yl)methyl]piperidin-3-yl]methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 125024022 |
| Molecular Formula | C19H24N6 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 3-[[(3S)-1-[(1-methylbenzimidazol-2-yl)methyl]piperidin-3-yl]methyl]pyrazin-2-amine |
| SMILES | Cn1c(CN2CCC[C@@H](Cc3nccnc3N)C2)nc2ccccc21 |
| InChI | InChI=1S/C19H24N6/c1-24-17-7-3-2-6-15(17)23-18(24)13-25-10-4-5-14(12-25)11-16-19(20)22-9-8-21-16/h2-3,6-9,14H,4-5,10-13H2,1H3,(H2,20,22)/t14-/m0/s1 |
| InChIKey | ZCNTUUUXXLDJLP-AWEZNQCLSA-N |
| XLogP | 2.40 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |