About 3-[[(3S)-1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]pyrazin-2-amine
3-[[(3S)-1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]pyrazin-2-amine (PubChem CID 125025118) has the molecular formula C13H19F3N4
and a molecular weight of 288.32 g/mol. Its IUPAC name is 3-[[(3S)-1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-[[(3S)-1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]pyrazin-2-amine |
| PubChem CID | 125025118 |
| Molecular Formula | C13H19F3N4 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 3-[[(3S)-1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]pyrazin-2-amine |
| SMILES | Nc1nccnc1C[C@@H]1CCCN(CCC(F)(F)F)C1 |
| InChI | InChI=1S/C13H19F3N4/c14-13(15,16)3-7-20-6-1-2-10(9-20)8-11-12(17)19-5-4-18-11/h4-5,10H,1-3,6-9H2,(H2,17,19)/t10-/m0/s1 |
| InChIKey | ZKEZVWAKJDAUJU-JTQLQIEISA-N |
| XLogP | 2.27 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[(3S)-1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3S)-1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]pyrazin-2-amine?
The IUPAC name of 3-[[(3S)-1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]pyrazin-2-amine (CID 125025118) is 3-[[(3S)-1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]pyrazin-2-amine.
What is the SMILES notation for 3-[[(3S)-1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]pyrazin-2-amine?
The canonical SMILES for 3-[[(3S)-1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]pyrazin-2-amine is Nc1nccnc1C[C@@H]1CCCN(CCC(F)(F)F)C1.
What is the InChIKey of 3-[[(3S)-1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]pyrazin-2-amine?
The InChIKey is ZKEZVWAKJDAUJU-JTQLQIEISA-N. The full InChI is InChI=1S/C13H19F3N4/c14-13(15,16)3-7-20-6-1-2-10(9-20)8-11-12(17)19-5-4-18-11/h4-5,10H,1-3,6-9H2,(H2,17,19)/t10-/m0/s1.
What are the key properties of 3-[[(3S)-1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]pyrazin-2-amine?
3-[[(3S)-1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]pyrazin-2-amine has a molecular weight of 288.32 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3S)-1-(3,3,3-trifluoropropyl)piperidin-3-yl]methyl]pyrazin-2-amine is sourced from PubChem (CID 125025118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).