C19H23N5 — CID 110113201
3-[[1-(1H-indol-6-ylmethyl)piperidin-3-yl]methyl]pyrazin-2-amine (PubChem CID 110113201) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is 3-[[1-(1H-indol-6-ylmethyl)piperidin-3-yl]methyl]pyrazin-2-amine.
| Compound Name | 3-[[1-(1H-indol-6-ylmethyl)piperidin-3-yl]methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 110113201 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 3-[[1-(1H-indol-6-ylmethyl)piperidin-3-yl]methyl]pyrazin-2-amine |
| SMILES | Nc1nccnc1CC1CCCN(Cc2ccc3cc[nH]c3c2)C1 |
| InChI | InChI=1S/C19H23N5/c20-19-18(22-7-8-23-19)11-14-2-1-9-24(12-14)13-15-3-4-16-5-6-21-17(16)10-15/h3-8,10,14,21H,1-2,9,11-13H2,(H2,20,23) |
| InChIKey | RMMFWMUBOPWPKN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |