C15H20N6 — CID 110113118
3-[[1-(pyrimidin-5-ylmethyl)piperidin-3-yl]methyl]pyrazin-2-amine (PubChem CID 110113118) has the molecular formula C15H20N6 and a molecular weight of 284.37 g/mol. Its IUPAC name is 3-[[1-(pyrimidin-5-ylmethyl)piperidin-3-yl]methyl]pyrazin-2-amine.
| Compound Name | 3-[[1-(pyrimidin-5-ylmethyl)piperidin-3-yl]methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 110113118 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 3-[[1-(pyrimidin-5-ylmethyl)piperidin-3-yl]methyl]pyrazin-2-amine |
| SMILES | Nc1nccnc1CC1CCCN(Cc2cncnc2)C1 |
| InChI | InChI=1S/C15H20N6/c16-15-14(19-3-4-20-15)6-12-2-1-5-21(9-12)10-13-7-17-11-18-8-13/h3-4,7-8,11-12H,1-2,5-6,9-10H2,(H2,16,20) |
| InChIKey | UCFKLSBTMMAQSW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |