C15H19N5O — CID 124943315
4-imidazol-1-yl-1-[(2S)-2-pyrazin-2-ylpyrrolidin-1-yl]butan-1-one (PubChem CID 124943315) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is 4-imidazol-1-yl-1-[(2S)-2-pyrazin-2-ylpyrrolidin-1-yl]butan-1-one.
| Compound Name | 4-imidazol-1-yl-1-[(2S)-2-pyrazin-2-ylpyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 124943315 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 4-imidazol-1-yl-1-[(2S)-2-pyrazin-2-ylpyrrolidin-1-yl]butan-1-one |
| SMILES | O=C(CCCn1ccnc1)N1CCC[C@H]1c1cnccn1 |
| InChI | InChI=1S/C15H19N5O/c21-15(4-2-8-19-10-7-17-12-19)20-9-1-3-14(20)13-11-16-5-6-18-13/h5-7,10-12,14H,1-4,8-9H2/t14-/m0/s1 |
| InChIKey | BBPWOZFIPRGXQC-AWEZNQCLSA-N |
| XLogP | 1.82 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |