C19H21N3OS — CID 124946584
(6S)-6-(quinolin-6-ylmethyl)-4-(1,3-thiazol-4-ylmethyl)-1,4-oxazepane (PubChem CID 124946584) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is (6S)-6-(quinolin-6-ylmethyl)-4-(1,3-thiazol-4-ylmethyl)-1,4-oxazepane.
| Compound Name | (6S)-6-(quinolin-6-ylmethyl)-4-(1,3-thiazol-4-ylmethyl)-1,4-oxazepane |
|---|---|
| PubChem CID | 124946584 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | (6S)-6-(quinolin-6-ylmethyl)-4-(1,3-thiazol-4-ylmethyl)-1,4-oxazepane |
| SMILES | c1cnc2ccc(C[C@@H]3COCCN(Cc4cscn4)C3)cc2c1 |
| InChI | InChI=1S/C19H21N3OS/c1-2-17-9-15(3-4-19(17)20-5-1)8-16-10-22(6-7-23-12-16)11-18-13-24-14-21-18/h1-5,9,13-14,16H,6-8,10-12H2/t16-/m0/s1 |
| InChIKey | BZFHAHYIBKPJRS-INIZCTEOSA-N |
| XLogP | 3.38 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |