C20H23N3O — CID 127245807
6-(1H-indol-5-ylmethyl)-4-(pyridin-2-ylmethyl)-1,4-oxazepane (PubChem CID 127245807) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 6-(1H-indol-5-ylmethyl)-4-(pyridin-2-ylmethyl)-1,4-oxazepane.
| Compound Name | 6-(1H-indol-5-ylmethyl)-4-(pyridin-2-ylmethyl)-1,4-oxazepane |
|---|---|
| PubChem CID | 127245807 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 6-(1H-indol-5-ylmethyl)-4-(pyridin-2-ylmethyl)-1,4-oxazepane |
| SMILES | c1ccc(CN2CCOCC(Cc3ccc4[nH]ccc4c3)C2)nc1 |
| InChI | InChI=1S/C20H23N3O/c1-2-7-21-19(3-1)14-23-9-10-24-15-17(13-23)11-16-4-5-20-18(12-16)6-8-22-20/h1-8,12,17,22H,9-11,13-15H2 |
| InChIKey | UUDOQKWUAQMJOG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |