C18H24N2O — CID 125013548
(6S)-4-(cyclopropylmethyl)-6-(1H-indol-5-ylmethyl)-1,4-oxazepane (PubChem CID 125013548) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is (6S)-4-(cyclopropylmethyl)-6-(1H-indol-5-ylmethyl)-1,4-oxazepane.
| Compound Name | (6S)-4-(cyclopropylmethyl)-6-(1H-indol-5-ylmethyl)-1,4-oxazepane |
|---|---|
| PubChem CID | 125013548 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | (6S)-4-(cyclopropylmethyl)-6-(1H-indol-5-ylmethyl)-1,4-oxazepane |
| SMILES | c1cc2cc(C[C@@H]3COCCN(CC4CC4)C3)ccc2[nH]1 |
| InChI | InChI=1S/C18H24N2O/c1-2-14(1)11-20-7-8-21-13-16(12-20)9-15-3-4-18-17(10-15)5-6-19-18/h3-6,10,14,16,19H,1-2,7-9,11-13H2/t16-/m0/s1 |
| InChIKey | WGBQEPBPWVRYGF-INIZCTEOSA-N |
| XLogP | 3.07 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |