C17H22N2O — CID 124963938
(6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane (PubChem CID 124963938) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane.
| Compound Name | (6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane |
|---|---|
| PubChem CID | 124963938 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane |
| SMILES | C=CCN1CCOC[C@@H](Cc2ccc3[nH]ccc3c2)C1 |
| InChI | InChI=1S/C17H22N2O/c1-2-7-19-8-9-20-13-15(12-19)10-14-3-4-17-16(11-14)5-6-18-17/h2-6,11,15,18H,1,7-10,12-13H2/t15-/m0/s1 |
| InChIKey | HTUVQNYRPRPVDS-HNNXBMFYSA-N |
| XLogP | 2.84 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|