About (6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane
(6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane (PubChem CID 124963938) has the molecular formula C17H22N2O
and a molecular weight of 270.38 g/mol. Its IUPAC name is (6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane.
Molecular Properties
| Compound Name | (6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane |
| PubChem CID | 124963938 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane |
| SMILES | C=CCN1CCOC[C@@H](Cc2ccc3[nH]ccc3c2)C1 |
| InChI | InChI=1S/C17H22N2O/c1-2-7-19-8-9-20-13-15(12-19)10-14-3-4-17-16(11-14)5-6-18-17/h2-6,11,15,18H,1,7-10,12-13H2/t15-/m0/s1 |
| InChIKey | HTUVQNYRPRPVDS-HNNXBMFYSA-N |
| XLogP | 2.84 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane?
The IUPAC name of (6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane (CID 124963938) is (6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane.
What is the SMILES notation for (6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane?
The canonical SMILES for (6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane is C=CCN1CCOC[C@@H](Cc2ccc3[nH]ccc3c2)C1.
What is the InChIKey of (6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane?
The InChIKey is HTUVQNYRPRPVDS-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H22N2O/c1-2-7-19-8-9-20-13-15(12-19)10-14-3-4-17-16(11-14)5-6-18-17/h2-6,11,15,18H,1,7-10,12-13H2/t15-/m0/s1.
What are the key properties of (6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane?
(6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane has a molecular weight of 270.38 g/mol, XLogP of 2.84, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-6-(1H-indol-5-ylmethyl)-4-prop-2-enyl-1,4-oxazepane is sourced from PubChem (CID 124963938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).