C18H22N2O — CID 125016191
(6S)-4-benzyl-6-(pyridin-2-ylmethyl)-1,4-oxazepane (PubChem CID 125016191) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is (6S)-4-benzyl-6-(pyridin-2-ylmethyl)-1,4-oxazepane.
| Compound Name | (6S)-4-benzyl-6-(pyridin-2-ylmethyl)-1,4-oxazepane |
|---|---|
| PubChem CID | 125016191 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (6S)-4-benzyl-6-(pyridin-2-ylmethyl)-1,4-oxazepane |
| SMILES | c1ccc(CN2CCOC[C@@H](Cc3ccccn3)C2)cc1 |
| InChI | InChI=1S/C18H22N2O/c1-2-6-16(7-3-1)13-20-10-11-21-15-17(14-20)12-18-8-4-5-9-19-18/h1-9,17H,10-15H2/t17-/m0/s1 |
| InChIKey | WYVIEYPVWTXGPD-KRWDZBQOSA-N |
| XLogP | 2.77 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |