C16H20N4OS — CID 124947110
[(2S)-2-[6-[(dimethylamino)methyl]pyrazin-2-yl]pyrrolidin-1-yl]-thiophen-3-ylmethanone (PubChem CID 124947110) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is [(2S)-2-[6-[(dimethylamino)methyl]pyrazin-2-yl]pyrrolidin-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [(2S)-2-[6-[(dimethylamino)methyl]pyrazin-2-yl]pyrrolidin-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 124947110 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | [(2S)-2-[6-[(dimethylamino)methyl]pyrazin-2-yl]pyrrolidin-1-yl]-thiophen-3-ylmethanone |
| SMILES | CN(C)Cc1cncc([C@@H]2CCCN2C(=O)c2ccsc2)n1 |
| InChI | InChI=1S/C16H20N4OS/c1-19(2)10-13-8-17-9-14(18-13)15-4-3-6-20(15)16(21)12-5-7-22-11-12/h5,7-9,11,15H,3-4,6,10H2,1-2H3/t15-/m0/s1 |
| InChIKey | CDKMWVFEENQTMP-HNNXBMFYSA-N |
| XLogP | 2.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |