C19H23N3OS — CID 110107647
[2-[6-(pyrrolidin-1-ylmethyl)-2-pyridinyl]pyrrolidin-1-yl]-thiophen-3-ylmethanone (PubChem CID 110107647) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is [2-[6-(pyrrolidin-1-ylmethyl)-2-pyridinyl]pyrrolidin-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [2-[6-(pyrrolidin-1-ylmethyl)-2-pyridinyl]pyrrolidin-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 110107647 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [2-[6-(pyrrolidin-1-ylmethyl)-2-pyridinyl]pyrrolidin-1-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CCCC1c1cccc(CN2CCCC2)n1 |
| InChI | InChI=1S/C19H23N3OS/c23-19(15-8-12-24-14-15)22-11-4-7-18(22)17-6-3-5-16(20-17)13-21-9-1-2-10-21/h3,5-6,8,12,14,18H,1-2,4,7,9-11,13H2 |
| InChIKey | AAOARSIQDLZZAE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |