C21H31N3O2 — CID 124982918
2-cyclopentyl-1-[(2S)-2-[6-(morpholin-4-ylmethyl)-2-pyridinyl]pyrrolidin-1-yl]ethanone (PubChem CID 124982918) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-cyclopentyl-1-[(2S)-2-[6-(morpholin-4-ylmethyl)-2-pyridinyl]pyrrolidin-1-yl]ethanone.
| Compound Name | 2-cyclopentyl-1-[(2S)-2-[6-(morpholin-4-ylmethyl)-2-pyridinyl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 124982918 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 2-cyclopentyl-1-[(2S)-2-[6-(morpholin-4-ylmethyl)-2-pyridinyl]pyrrolidin-1-yl]ethanone |
| SMILES | O=C(CC1CCCC1)N1CCC[C@H]1c1cccc(CN2CCOCC2)n1 |
| InChI | InChI=1S/C21H31N3O2/c25-21(15-17-5-1-2-6-17)24-10-4-9-20(24)19-8-3-7-18(22-19)16-23-11-13-26-14-12-23/h3,7-8,17,20H,1-2,4-6,9-16H2/t20-/m0/s1 |
| InChIKey | NAKATUYQKAEHNQ-FQEVSTJZSA-N |
| XLogP | 3.16 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |