C14H19N5 — CID 124948496
2-(5-methyl-1H-pyrazol-3-yl)-3-[[(3R)-piperidin-3-yl]methyl]pyrazine (PubChem CID 124948496) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-(5-methyl-1H-pyrazol-3-yl)-3-[[(3R)-piperidin-3-yl]methyl]pyrazine.
| Compound Name | 2-(5-methyl-1H-pyrazol-3-yl)-3-[[(3R)-piperidin-3-yl]methyl]pyrazine |
|---|---|
| PubChem CID | 124948496 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-(5-methyl-1H-pyrazol-3-yl)-3-[[(3R)-piperidin-3-yl]methyl]pyrazine |
| SMILES | Cc1cc(-c2nccnc2C[C@H]2CCCNC2)n[nH]1 |
| InChI | InChI=1S/C14H19N5/c1-10-7-13(19-18-10)14-12(16-5-6-17-14)8-11-3-2-4-15-9-11/h5-7,11,15H,2-4,8-9H2,1H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | CNKDMTSLJGECPP-LLVKDONJSA-N |
| XLogP | 1.72 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |