C16H23N5 — CID 110102127
2-(piperidin-3-ylmethyl)-3-(1-propylpyrazol-4-yl)pyrazine (PubChem CID 110102127) has the molecular formula C16H23N5 and a molecular weight of 285.40 g/mol. Its IUPAC name is 2-(piperidin-3-ylmethyl)-3-(1-propylpyrazol-4-yl)pyrazine.
| Compound Name | 2-(piperidin-3-ylmethyl)-3-(1-propylpyrazol-4-yl)pyrazine |
|---|---|
| PubChem CID | 110102127 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 2-(piperidin-3-ylmethyl)-3-(1-propylpyrazol-4-yl)pyrazine |
| SMILES | CCCn1cc(-c2nccnc2CC2CCCNC2)cn1 |
| InChI | InChI=1S/C16H23N5/c1-2-8-21-12-14(11-20-21)16-15(18-6-7-19-16)9-13-4-3-5-17-10-13/h6-7,11-13,17H,2-5,8-10H2,1H3 |
| InChIKey | KZXPDZZBKCEHTH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |