C20H28N4O — CID 95726413
4-[[(3R)-piperidin-3-yl]methyl]-N-[(1-propylpyrazol-4-yl)methyl]benzamide (PubChem CID 95726413) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is 4-[[(3R)-piperidin-3-yl]methyl]-N-[(1-propylpyrazol-4-yl)methyl]benzamide.
| Compound Name | 4-[[(3R)-piperidin-3-yl]methyl]-N-[(1-propylpyrazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 95726413 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 4-[[(3R)-piperidin-3-yl]methyl]-N-[(1-propylpyrazol-4-yl)methyl]benzamide |
| SMILES | CCCn1cc(CNC(=O)c2ccc(C[C@H]3CCCNC3)cc2)cn1 |
| InChI | InChI=1S/C20H28N4O/c1-2-10-24-15-18(14-23-24)13-22-20(25)19-7-5-16(6-8-19)11-17-4-3-9-21-12-17/h5-8,14-15,17,21H,2-4,9-13H2,1H3,(H,22,25)/t17-/m1/s1 |
| InChIKey | TWXRQDJCKHAOQR-QGZVFWFLSA-N |
| XLogP | 2.77 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |