C27H29N3O3 — CID 124950685
3-[6-[(2S)-4-[2-methyl-2-(4-methylphenyl)propanoyl]morpholin-2-yl]-2-pyridinyl]benzamide (PubChem CID 124950685) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 3-[6-[(2S)-4-[2-methyl-2-(4-methylphenyl)propanoyl]morpholin-2-yl]-2-pyridinyl]benzamide.
| Compound Name | 3-[6-[(2S)-4-[2-methyl-2-(4-methylphenyl)propanoyl]morpholin-2-yl]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 124950685 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 3-[6-[(2S)-4-[2-methyl-2-(4-methylphenyl)propanoyl]morpholin-2-yl]-2-pyridinyl]benzamide |
| SMILES | Cc1ccc(C(C)(C)C(=O)N2CCO[C@H](c3cccc(-c4cccc(C(N)=O)c4)n3)C2)cc1 |
| InChI | InChI=1S/C27H29N3O3/c1-18-10-12-21(13-11-18)27(2,3)26(32)30-14-15-33-24(17-30)23-9-5-8-22(29-23)19-6-4-7-20(16-19)25(28)31/h4-13,16,24H,14-15,17H2,1-3H3,(H2,28,31)/t24-/m0/s1 |
| InChIKey | DDIXXHRITFZUMO-DEOSSOPVSA-N |
| XLogP | 4.03 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |