C23H20FN3O3 — CID 124951464
4-[6-[(2S)-4-(4-fluorobenzoyl)morpholin-2-yl]-2-pyridinyl]benzamide (PubChem CID 124951464) has the molecular formula C23H20FN3O3 and a molecular weight of 405.43 g/mol. Its IUPAC name is 4-[6-[(2S)-4-(4-fluorobenzoyl)morpholin-2-yl]-2-pyridinyl]benzamide.
| Compound Name | 4-[6-[(2S)-4-(4-fluorobenzoyl)morpholin-2-yl]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 124951464 |
| Molecular Formula | C23H20FN3O3 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 4-[6-[(2S)-4-(4-fluorobenzoyl)morpholin-2-yl]-2-pyridinyl]benzamide |
| SMILES | NC(=O)c1ccc(-c2cccc([C@@H]3CN(C(=O)c4ccc(F)cc4)CCO3)n2)cc1 |
| InChI | InChI=1S/C23H20FN3O3/c24-18-10-8-17(9-11-18)23(29)27-12-13-30-21(14-27)20-3-1-2-19(26-20)15-4-6-16(7-5-15)22(25)28/h1-11,21H,12-14H2,(H2,25,28)/t21-/m0/s1 |
| InChIKey | DHZUPYSPZAECGV-NRFANRHFSA-N |
| XLogP | 3.20 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |