C22H28N4O3 — CID 125019777
4-[6-[(2R)-4-[2-(diethylamino)-2-oxoethyl]morpholin-2-yl]-2-pyridinyl]benzamide (PubChem CID 125019777) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 4-[6-[(2R)-4-[2-(diethylamino)-2-oxoethyl]morpholin-2-yl]-2-pyridinyl]benzamide.
| Compound Name | 4-[6-[(2R)-4-[2-(diethylamino)-2-oxoethyl]morpholin-2-yl]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 125019777 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 4-[6-[(2R)-4-[2-(diethylamino)-2-oxoethyl]morpholin-2-yl]-2-pyridinyl]benzamide |
| SMILES | CCN(CC)C(=O)CN1CCO[C@@H](c2cccc(-c3ccc(C(N)=O)cc3)n2)C1 |
| InChI | InChI=1S/C22H28N4O3/c1-3-26(4-2)21(27)15-25-12-13-29-20(14-25)19-7-5-6-18(24-19)16-8-10-17(11-9-16)22(23)28/h5-11,20H,3-4,12-15H2,1-2H3,(H2,23,28)/t20-/m1/s1 |
| InChIKey | XYHHDZCYXYUTLK-HXUWFJFHSA-N |
| XLogP | 2.09 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |