C25H24N4O3 — CID 124956255
2-(1H-indol-3-yl)-1-[(2S)-2-[6-(3-methoxyphenyl)pyrazin-2-yl]morpholin-4-yl]ethanone (PubChem CID 124956255) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-1-[(2S)-2-[6-(3-methoxyphenyl)pyrazin-2-yl]morpholin-4-yl]ethanone.
| Compound Name | 2-(1H-indol-3-yl)-1-[(2S)-2-[6-(3-methoxyphenyl)pyrazin-2-yl]morpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 124956255 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-(1H-indol-3-yl)-1-[(2S)-2-[6-(3-methoxyphenyl)pyrazin-2-yl]morpholin-4-yl]ethanone |
| SMILES | COc1cccc(-c2cncc([C@@H]3CN(C(=O)Cc4c[nH]c5ccccc45)CCO3)n2)c1 |
| InChI | InChI=1S/C25H24N4O3/c1-31-19-6-4-5-17(11-19)22-14-26-15-23(28-22)24-16-29(9-10-32-24)25(30)12-18-13-27-21-8-3-2-7-20(18)21/h2-8,11,13-15,24,27H,9-10,12,16H2,1H3/t24-/m0/s1 |
| InChIKey | FQEWHGITCSLRER-DEOSSOPVSA-N |
| XLogP | 3.78 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |