C19H26N4O4S — CID 125000431
(2R)-N,N-diethyl-2-[6-(3-methoxyphenyl)pyrazin-2-yl]morpholine-4-sulfonamide (PubChem CID 125000431) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is (2R)-N,N-diethyl-2-[6-(3-methoxyphenyl)pyrazin-2-yl]morpholine-4-sulfonamide.
| Compound Name | (2R)-N,N-diethyl-2-[6-(3-methoxyphenyl)pyrazin-2-yl]morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 125000431 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (2R)-N,N-diethyl-2-[6-(3-methoxyphenyl)pyrazin-2-yl]morpholine-4-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCO[C@@H](c2cncc(-c3cccc(OC)c3)n2)C1 |
| InChI | InChI=1S/C19H26N4O4S/c1-4-22(5-2)28(24,25)23-9-10-27-19(14-23)18-13-20-12-17(21-18)15-7-6-8-16(11-15)26-3/h6-8,11-13,19H,4-5,9-10,14H2,1-3H3/t19-/m1/s1 |
| InChIKey | RVSSHEDQOVSFBG-LJQANCHMSA-N |
| XLogP | 2.11 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |