About (3S)-N,N-dimethyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine-1-sulfonamide
(3S)-N,N-dimethyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine-1-sulfonamide (PubChem CID 124956608) has the molecular formula C11H20N4O4S2
and a molecular weight of 336.44 g/mol. Its IUPAC name is (3S)-N,N-dimethyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine-1-sulfonamide.
Molecular Properties
| Compound Name | (3S)-N,N-dimethyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine-1-sulfonamide |
| PubChem CID | 124956608 |
| Molecular Formula | C11H20N4O4S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | (3S)-N,N-dimethyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCC[C@H](c2[nH]ncc2S(C)(=O)=O)C1 |
| InChI | InChI=1S/C11H20N4O4S2/c1-14(2)21(18,19)15-6-4-5-9(8-15)11-10(7-12-13-11)20(3,16)17/h7,9H,4-6,8H2,1-3H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | FSTYHFKUDKEWPE-VIFPVBQESA-N |
| XLogP | -0.20 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-N,N-dimethyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N,N-dimethyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine-1-sulfonamide?
The IUPAC name of (3S)-N,N-dimethyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine-1-sulfonamide (CID 124956608) is (3S)-N,N-dimethyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine-1-sulfonamide.
What is the SMILES notation for (3S)-N,N-dimethyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine-1-sulfonamide?
The canonical SMILES for (3S)-N,N-dimethyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine-1-sulfonamide is CN(C)S(=O)(=O)N1CCC[C@H](c2[nH]ncc2S(C)(=O)=O)C1.
What is the InChIKey of (3S)-N,N-dimethyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine-1-sulfonamide?
The InChIKey is FSTYHFKUDKEWPE-VIFPVBQESA-N. The full InChI is InChI=1S/C11H20N4O4S2/c1-14(2)21(18,19)15-6-4-5-9(8-15)11-10(7-12-13-11)20(3,16)17/h7,9H,4-6,8H2,1-3H3,(H,12,13)/t9-/m0/s1.
What are the key properties of (3S)-N,N-dimethyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine-1-sulfonamide?
(3S)-N,N-dimethyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine-1-sulfonamide has a molecular weight of 336.44 g/mol, XLogP of -0.20, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N,N-dimethyl-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine-1-sulfonamide is sourced from PubChem (CID 124956608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).