C15H19N5O3S — CID 95829703
(5-methylpyrazin-2-yl)-[(3S)-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone (PubChem CID 95829703) has the molecular formula C15H19N5O3S and a molecular weight of 349.42 g/mol. Its IUPAC name is (5-methylpyrazin-2-yl)-[(3S)-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone.
| Compound Name | (5-methylpyrazin-2-yl)-[(3S)-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95829703 |
| Molecular Formula | C15H19N5O3S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (5-methylpyrazin-2-yl)-[(3S)-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone |
| SMILES | Cc1cnc(C(=O)N2CCC[C@H](c3[nH]ncc3S(C)(=O)=O)C2)cn1 |
| InChI | InChI=1S/C15H19N5O3S/c1-10-6-17-12(7-16-10)15(21)20-5-3-4-11(9-20)14-13(8-18-19-14)24(2,22)23/h6-8,11H,3-5,9H2,1-2H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | GTQOSFZQYKBYCQ-NSHDSACASA-N |
| XLogP | 0.93 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |