C14H16N4O3S — CID 125001889
[(3R)-3-(4-methylsulfonyl-1H-pyrazol-5-yl)pyrrolidin-1-yl]-pyridin-2-ylmethanone (PubChem CID 125001889) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is [(3R)-3-(4-methylsulfonyl-1H-pyrazol-5-yl)pyrrolidin-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [(3R)-3-(4-methylsulfonyl-1H-pyrazol-5-yl)pyrrolidin-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 125001889 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | [(3R)-3-(4-methylsulfonyl-1H-pyrazol-5-yl)pyrrolidin-1-yl]-pyridin-2-ylmethanone |
| SMILES | CS(=O)(=O)c1cn[nH]c1[C@@H]1CCN(C(=O)c2ccccn2)C1 |
| InChI | InChI=1S/C14H16N4O3S/c1-22(20,21)12-8-16-17-13(12)10-5-7-18(9-10)14(19)11-4-2-3-6-15-11/h2-4,6,8,10H,5,7,9H2,1H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | SGLHRYLCDJUDJC-SNVBAGLBSA-N |
| XLogP | 0.84 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |