C14H17N3O3S2 — CID 127247209
1-[3-(4-methylsulfonyl-1H-pyrazol-5-yl)pyrrolidin-1-yl]-2-thiophen-3-ylethanone (PubChem CID 127247209) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-[3-(4-methylsulfonyl-1H-pyrazol-5-yl)pyrrolidin-1-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[3-(4-methylsulfonyl-1H-pyrazol-5-yl)pyrrolidin-1-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 127247209 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 1-[3-(4-methylsulfonyl-1H-pyrazol-5-yl)pyrrolidin-1-yl]-2-thiophen-3-ylethanone |
| SMILES | CS(=O)(=O)c1cn[nH]c1C1CCN(C(=O)Cc2ccsc2)C1 |
| InChI | InChI=1S/C14H17N3O3S2/c1-22(19,20)12-7-15-16-14(12)11-2-4-17(8-11)13(18)6-10-3-5-21-9-10/h3,5,7,9,11H,2,4,6,8H2,1H3,(H,15,16) |
| InChIKey | BSUKJZSRRYFPPH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |