C14H19N5O3S — CID 175652651
(2-methylpyrazol-3-yl)-[3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone (PubChem CID 175652651) has the molecular formula C14H19N5O3S and a molecular weight of 337.41 g/mol. Its IUPAC name is (2-methylpyrazol-3-yl)-[3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone.
| Compound Name | (2-methylpyrazol-3-yl)-[3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 175652651 |
| Molecular Formula | C14H19N5O3S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | (2-methylpyrazol-3-yl)-[3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone |
| SMILES | Cn1nccc1C(=O)N1CCCC(c2[nH]ncc2S(C)(=O)=O)C1 |
| InChI | InChI=1S/C14H19N5O3S/c1-18-11(5-6-16-18)14(20)19-7-3-4-10(9-19)13-12(8-15-17-13)23(2,21)22/h5-6,8,10H,3-4,7,9H2,1-2H3,(H,15,17) |
| InChIKey | BDKKNHLQOWQBQP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |