C18H20N6O — CID 124958322
2-(benzotriazol-1-yl)-1-[(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]ethanone (PubChem CID 124958322) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-1-[(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-(benzotriazol-1-yl)-1-[(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 124958322 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-(benzotriazol-1-yl)-1-[(3R)-3-(6-methylpyrazin-2-yl)piperidin-1-yl]ethanone |
| SMILES | Cc1cncc([C@@H]2CCCN(C(=O)Cn3nnc4ccccc43)C2)n1 |
| InChI | InChI=1S/C18H20N6O/c1-13-9-19-10-16(20-13)14-5-4-8-23(11-14)18(25)12-24-17-7-3-2-6-15(17)21-22-24/h2-3,6-7,9-10,14H,4-5,8,11-12H2,1H3/t14-/m1/s1 |
| InChIKey | GFJRRWFKVQWXRX-CQSZACIVSA-N |
| XLogP | 1.94 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |