C20H27N3O3 — CID 124963457
2-[3-[[(2S)-2-[2-(2-amino-4-pyridinyl)ethyl]morpholin-4-yl]methyl]phenoxy]ethanol (PubChem CID 124963457) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-[3-[[(2S)-2-[2-(2-amino-4-pyridinyl)ethyl]morpholin-4-yl]methyl]phenoxy]ethanol.
| Compound Name | 2-[3-[[(2S)-2-[2-(2-amino-4-pyridinyl)ethyl]morpholin-4-yl]methyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 124963457 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 2-[3-[[(2S)-2-[2-(2-amino-4-pyridinyl)ethyl]morpholin-4-yl]methyl]phenoxy]ethanol |
| SMILES | Nc1cc(CC[C@H]2CN(Cc3cccc(OCCO)c3)CCO2)ccn1 |
| InChI | InChI=1S/C20H27N3O3/c21-20-13-16(6-7-22-20)4-5-19-15-23(8-10-25-19)14-17-2-1-3-18(12-17)26-11-9-24/h1-3,6-7,12-13,19,24H,4-5,8-11,14-15H2,(H2,21,22)/t19-/m0/s1 |
| InChIKey | HQIXEXPAULPNAU-IBGZPJMESA-N |
| XLogP | 1.87 |
| TPSA | 80.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |