C19H23FN4O — CID 124964415
2-(3-fluorophenyl)-1-[(3S)-3-[[3-(methylamino)pyrazin-2-yl]methyl]piperidin-1-yl]ethanone (PubChem CID 124964415) has the molecular formula C19H23FN4O and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-[(3S)-3-[[3-(methylamino)pyrazin-2-yl]methyl]piperidin-1-yl]ethanone.
| Compound Name | 2-(3-fluorophenyl)-1-[(3S)-3-[[3-(methylamino)pyrazin-2-yl]methyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 124964415 |
| Molecular Formula | C19H23FN4O |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-(3-fluorophenyl)-1-[(3S)-3-[[3-(methylamino)pyrazin-2-yl]methyl]piperidin-1-yl]ethanone |
| SMILES | CNc1nccnc1C[C@@H]1CCCN(C(=O)Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H23FN4O/c1-21-19-17(22-7-8-23-19)11-15-5-3-9-24(13-15)18(25)12-14-4-2-6-16(20)10-14/h2,4,6-8,10,15H,3,5,9,11-13H2,1H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | HXJZBCKCEPUILG-HNNXBMFYSA-N |
| XLogP | 2.68 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |