C18H26N6O — CID 125012361
1-[(3S)-3-[[3-(methylamino)pyrazin-2-yl]methyl]piperidin-1-yl]-4-pyrazol-1-ylbutan-1-one (PubChem CID 125012361) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is 1-[(3S)-3-[[3-(methylamino)pyrazin-2-yl]methyl]piperidin-1-yl]-4-pyrazol-1-ylbutan-1-one.
| Compound Name | 1-[(3S)-3-[[3-(methylamino)pyrazin-2-yl]methyl]piperidin-1-yl]-4-pyrazol-1-ylbutan-1-one |
|---|---|
| PubChem CID | 125012361 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-[(3S)-3-[[3-(methylamino)pyrazin-2-yl]methyl]piperidin-1-yl]-4-pyrazol-1-ylbutan-1-one |
| SMILES | CNc1nccnc1C[C@@H]1CCCN(C(=O)CCCn2cccn2)C1 |
| InChI | InChI=1S/C18H26N6O/c1-19-18-16(20-8-9-21-18)13-15-5-2-10-23(14-15)17(25)6-3-11-24-12-4-7-22-24/h4,7-9,12,15H,2-3,5-6,10-11,13-14H2,1H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | VWYCZBPGRBPVLO-HNNXBMFYSA-N |
| XLogP | 1.98 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |