C25H32N6O2S — CID 124964614
2-[5-[(2S)-2-(5-benzyl-1,3-oxazol-2-yl)piperidine-1-carbonyl]-4-methyl-1,3-thiazol-2-yl]-1,1,3,3-tetramethylguanidine (PubChem CID 124964614) has the molecular formula C25H32N6O2S and a molecular weight of 480.64 g/mol. Its IUPAC name is 2-[5-[(2S)-2-(5-benzyl-1,3-oxazol-2-yl)piperidine-1-carbonyl]-4-methyl-1,3-thiazol-2-yl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[5-[(2S)-2-(5-benzyl-1,3-oxazol-2-yl)piperidine-1-carbonyl]-4-methyl-1,3-thiazol-2-yl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 124964614 |
| Molecular Formula | C25H32N6O2S |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 2-[5-[(2S)-2-(5-benzyl-1,3-oxazol-2-yl)piperidine-1-carbonyl]-4-methyl-1,3-thiazol-2-yl]-1,1,3,3-tetramethylguanidine |
| SMILES | Cc1nc(N=C(N(C)C)N(C)C)sc1C(=O)N1CCCC[C@H]1c1ncc(Cc2ccccc2)o1 |
| InChI | InChI=1S/C25H32N6O2S/c1-17-21(34-24(27-17)28-25(29(2)3)30(4)5)23(32)31-14-10-9-13-20(31)22-26-16-19(33-22)15-18-11-7-6-8-12-18/h6-8,11-12,16,20H,9-10,13-15H2,1-5H3/t20-/m0/s1 |
| InChIKey | HYPNASGOPBJPQC-FQEVSTJZSA-N |
| XLogP | 4.51 |
| TPSA | 78.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|