C18H22FN3O2 — CID 124965856
(2R)-4-[3-(2-fluorophenoxy)propyl]-2-(2-methylpyrimidin-4-yl)morpholine (PubChem CID 124965856) has the molecular formula C18H22FN3O2 and a molecular weight of 331.39 g/mol. Its IUPAC name is (2R)-4-[3-(2-fluorophenoxy)propyl]-2-(2-methylpyrimidin-4-yl)morpholine.
| Compound Name | (2R)-4-[3-(2-fluorophenoxy)propyl]-2-(2-methylpyrimidin-4-yl)morpholine |
|---|---|
| PubChem CID | 124965856 |
| Molecular Formula | C18H22FN3O2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | (2R)-4-[3-(2-fluorophenoxy)propyl]-2-(2-methylpyrimidin-4-yl)morpholine |
| SMILES | Cc1nccc([C@H]2CN(CCCOc3ccccc3F)CCO2)n1 |
| InChI | InChI=1S/C18H22FN3O2/c1-14-20-8-7-16(21-14)18-13-22(10-12-24-18)9-4-11-23-17-6-3-2-5-15(17)19/h2-3,5-8,18H,4,9-13H2,1H3/t18-/m1/s1 |
| InChIKey | IHWGLADKXBMQRE-GOSISDBHSA-N |
| XLogP | 2.77 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|