C27H24N2O5 — CID 1249770
2-[4-(2-morpholin-4-yl-2-oxoethoxy)anilino]-2-phenylindene-1,3-dione (PubChem CID 1249770) has the molecular formula C27H24N2O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-[4-(2-morpholin-4-yl-2-oxoethoxy)anilino]-2-phenylindene-1,3-dione.
| Compound Name | 2-[4-(2-morpholin-4-yl-2-oxoethoxy)anilino]-2-phenylindene-1,3-dione |
|---|---|
| PubChem CID | 1249770 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 2-[4-(2-morpholin-4-yl-2-oxoethoxy)anilino]-2-phenylindene-1,3-dione |
| SMILES | O=C(COc1ccc(NC2(c3ccccc3)C(=O)c3ccccc3C2=O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C27H24N2O5/c30-24(29-14-16-33-17-15-29)18-34-21-12-10-20(11-13-21)28-27(19-6-2-1-3-7-19)25(31)22-8-4-5-9-23(22)26(27)32/h1-13,28H,14-18H2 |
| InChIKey | DYKFKSCMKBIILQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|