C18H25N5O2 — CID 124977181
(2R)-4-(4-methoxyphenyl)-N-[2-(3-methylpyrazol-1-yl)ethyl]piperazine-2-carboxamide (PubChem CID 124977181) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (2R)-4-(4-methoxyphenyl)-N-[2-(3-methylpyrazol-1-yl)ethyl]piperazine-2-carboxamide.
| Compound Name | (2R)-4-(4-methoxyphenyl)-N-[2-(3-methylpyrazol-1-yl)ethyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 124977181 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | (2R)-4-(4-methoxyphenyl)-N-[2-(3-methylpyrazol-1-yl)ethyl]piperazine-2-carboxamide |
| SMILES | COc1ccc(N2CCN[C@@H](C(=O)NCCn3ccc(C)n3)C2)cc1 |
| InChI | InChI=1S/C18H25N5O2/c1-14-7-10-23(21-14)12-9-20-18(24)17-13-22(11-8-19-17)15-3-5-16(25-2)6-4-15/h3-7,10,17,19H,8-9,11-13H2,1-2H3,(H,20,24)/t17-/m1/s1 |
| InChIKey | LKOZPGZWQSVNOU-QGZVFWFLSA-N |
| XLogP | 0.79 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|