C19H24N4O2 — CID 110086699
4-(4-methoxyphenyl)-N-(2-pyridin-2-ylethyl)piperazine-2-carboxamide (PubChem CID 110086699) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N-(2-pyridin-2-ylethyl)piperazine-2-carboxamide.
| Compound Name | 4-(4-methoxyphenyl)-N-(2-pyridin-2-ylethyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 110086699 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 4-(4-methoxyphenyl)-N-(2-pyridin-2-ylethyl)piperazine-2-carboxamide |
| SMILES | COc1ccc(N2CCNC(C(=O)NCCc3ccccn3)C2)cc1 |
| InChI | InChI=1S/C19H24N4O2/c1-25-17-7-5-16(6-8-17)23-13-12-21-18(14-23)19(24)22-11-9-15-4-2-3-10-20-15/h2-8,10,18,21H,9,11-14H2,1H3,(H,22,24) |
| InChIKey | PQQHVWIACJWOQJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|