C16H17N3O2 — CID 124979752
3-[3-[[(3S)-pyrrolidin-3-yl]methyl]pyrazin-2-yl]benzoic acid (PubChem CID 124979752) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 3-[3-[[(3S)-pyrrolidin-3-yl]methyl]pyrazin-2-yl]benzoic acid.
| Compound Name | 3-[3-[[(3S)-pyrrolidin-3-yl]methyl]pyrazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 124979752 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 3-[3-[[(3S)-pyrrolidin-3-yl]methyl]pyrazin-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2nccnc2C[C@@H]2CCNC2)c1 |
| InChI | InChI=1S/C16H17N3O2/c20-16(21)13-3-1-2-12(9-13)15-14(18-6-7-19-15)8-11-4-5-17-10-11/h1-3,6-7,9,11,17H,4-5,8,10H2,(H,20,21)/t11-/m0/s1 |
| InChIKey | MDQKYNGILZBOQT-NSHDSACASA-N |
| XLogP | 1.99 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |