C13H14N4O2 — CID 165488240
3-(3-pyrrolidin-3-yltriazol-4-yl)benzoic acid (PubChem CID 165488240) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 3-(3-pyrrolidin-3-yltriazol-4-yl)benzoic acid.
| Compound Name | 3-(3-pyrrolidin-3-yltriazol-4-yl)benzoic acid |
|---|---|
| PubChem CID | 165488240 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 3-(3-pyrrolidin-3-yltriazol-4-yl)benzoic acid |
| SMILES | O=C(O)c1cccc(-c2cnnn2C2CCNC2)c1 |
| InChI | InChI=1S/C13H14N4O2/c18-13(19)10-3-1-2-9(6-10)12-8-15-16-17(12)11-4-5-14-7-11/h1-3,6,8,11,14H,4-5,7H2,(H,18,19) |
| InChIKey | PIYUDIHPXLPOTR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |