9-[(3S)-pyrrolidin-3-yl]carbazole-2-carboxylic acid

C17H16N2O2 — CID 59626416

IUPAC9-[(3S)-pyrrolidin-3-yl]carbazole-2-carboxylic acid
SMILESO=C(O)c1ccc2c3ccccc3n([C@H]3CCNC3)c2c1
InChIInChI=1S/C17H16N2O2/c20-17(21)11-5-6-14-13-3-1-2-4-15(13)19(16(14)9-11)12-7-8-18-10-12/h1-6,9,12,18H,7-8,10H2,(H,20,21)/t12-/m0/s1
InChIKeyXLNDFDDQZSPWEE-LBPRGKRZSA-N
MW280.33 g/mol
LogP3.03
Rot. Bonds2

About 9-[(3S)-pyrrolidin-3-yl]carbazole-2-carboxylic acid

9-[(3S)-pyrrolidin-3-yl]carbazole-2-carboxylic acid (PubChem CID 59626416) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 9-[(3S)-pyrrolidin-3-yl]carbazole-2-carboxylic acid.

Molecular Properties

Compound Name9-[(3S)-pyrrolidin-3-yl]carbazole-2-carboxylic acid
PubChem CID59626416
Molecular FormulaC17H16N2O2
Molecular Weight280.33 g/mol
Exact Mass280.12
IUPAC Name9-[(3S)-pyrrolidin-3-yl]carbazole-2-carboxylic acid
SMILESO=C(O)c1ccc2c3ccccc3n([C@H]3CCNC3)c2c1
InChIInChI=1S/C17H16N2O2/c20-17(21)11-5-6-14-13-3-1-2-4-15(13)19(16(14)9-11)12-7-8-18-10-12/h1-6,9,12,18H,7-8,10H2,(H,20,21)/t12-/m0/s1
InChIKeyXLNDFDDQZSPWEE-LBPRGKRZSA-N
XLogP3.03
TPSA54.26 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.33
LogP ≤ 53.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 9-[(3S)-pyrrolidin-3-yl]carbazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9-[(3S)-pyrrolidin-3-yl]carbazole-2-carboxylic acid?
The IUPAC name of 9-[(3S)-pyrrolidin-3-yl]carbazole-2-carboxylic acid (CID 59626416) is 9-[(3S)-pyrrolidin-3-yl]carbazole-2-carboxylic acid.
What is the SMILES notation for 9-[(3S)-pyrrolidin-3-yl]carbazole-2-carboxylic acid?
The canonical SMILES for 9-[(3S)-pyrrolidin-3-yl]carbazole-2-carboxylic acid is O=C(O)c1ccc2c3ccccc3n([C@H]3CCNC3)c2c1.
What is the InChIKey of 9-[(3S)-pyrrolidin-3-yl]carbazole-2-carboxylic acid?
The InChIKey is XLNDFDDQZSPWEE-LBPRGKRZSA-N. The full InChI is InChI=1S/C17H16N2O2/c20-17(21)11-5-6-14-13-3-1-2-4-15(13)19(16(14)9-11)12-7-8-18-10-12/h1-6,9,12,18H,7-8,10H2,(H,20,21)/t12-/m0/s1.
What are the key properties of 9-[(3S)-pyrrolidin-3-yl]carbazole-2-carboxylic acid?
9-[(3S)-pyrrolidin-3-yl]carbazole-2-carboxylic acid has a molecular weight of 280.33 g/mol, XLogP of 3.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(3S)-pyrrolidin-3-yl]carbazole-2-carboxylic acid is sourced from PubChem (CID 59626416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).