C23H31N3O — CID 124980413
6-[(2S)-1-cyclohexylpyrrolidin-2-yl]-N-[(4-methoxyphenyl)methyl]pyridin-2-amine (PubChem CID 124980413) has the molecular formula C23H31N3O and a molecular weight of 365.52 g/mol. Its IUPAC name is 6-[(2S)-1-cyclohexylpyrrolidin-2-yl]-N-[(4-methoxyphenyl)methyl]pyridin-2-amine.
| Compound Name | 6-[(2S)-1-cyclohexylpyrrolidin-2-yl]-N-[(4-methoxyphenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 124980413 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 6-[(2S)-1-cyclohexylpyrrolidin-2-yl]-N-[(4-methoxyphenyl)methyl]pyridin-2-amine |
| SMILES | COc1ccc(CNc2cccc([C@@H]3CCCN3C3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C23H31N3O/c1-27-20-14-12-18(13-15-20)17-24-23-11-5-9-21(25-23)22-10-6-16-26(22)19-7-3-2-4-8-19/h5,9,11-15,19,22H,2-4,6-8,10,16-17H2,1H3,(H,24,25)/t22-/m0/s1 |
| InChIKey | MIPXGYSJLTVNAL-QFIPXVFZSA-N |
| XLogP | 5.17 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |