C24H33N3O2 — CID 124953976
6-[(2R)-1-cyclohexylpyrrolidin-2-yl]-N-[2-(4-methoxyphenoxy)ethyl]pyridin-2-amine (PubChem CID 124953976) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 6-[(2R)-1-cyclohexylpyrrolidin-2-yl]-N-[2-(4-methoxyphenoxy)ethyl]pyridin-2-amine.
| Compound Name | 6-[(2R)-1-cyclohexylpyrrolidin-2-yl]-N-[2-(4-methoxyphenoxy)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 124953976 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 6-[(2R)-1-cyclohexylpyrrolidin-2-yl]-N-[2-(4-methoxyphenoxy)ethyl]pyridin-2-amine |
| SMILES | COc1ccc(OCCNc2cccc([C@H]3CCCN3C3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C24H33N3O2/c1-28-20-12-14-21(15-13-20)29-18-16-25-24-11-5-9-22(26-24)23-10-6-17-27(23)19-7-3-2-4-8-19/h5,9,11-15,19,23H,2-4,6-8,10,16-18H2,1H3,(H,25,26)/t23-/m1/s1 |
| InChIKey | DZEUULOQXHSQSG-HSZRJFAPSA-N |
| XLogP | 5.05 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|