C15H24N4O2S — CID 124983194
6-[(2R)-1-cyclohexylsulfonylpyrrolidin-2-yl]-2-methylpyrimidin-4-amine (PubChem CID 124983194) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is 6-[(2R)-1-cyclohexylsulfonylpyrrolidin-2-yl]-2-methylpyrimidin-4-amine.
| Compound Name | 6-[(2R)-1-cyclohexylsulfonylpyrrolidin-2-yl]-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 124983194 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 6-[(2R)-1-cyclohexylsulfonylpyrrolidin-2-yl]-2-methylpyrimidin-4-amine |
| SMILES | Cc1nc(N)cc([C@H]2CCCN2S(=O)(=O)C2CCCCC2)n1 |
| InChI | InChI=1S/C15H24N4O2S/c1-11-17-13(10-15(16)18-11)14-8-5-9-19(14)22(20,21)12-6-3-2-4-7-12/h10,12,14H,2-9H2,1H3,(H2,16,17,18)/t14-/m1/s1 |
| InChIKey | NCEJHKARYYHIEM-CQSZACIVSA-N |
| XLogP | 2.17 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |