C15H18N4O2S — CID 110091079
6-[1-(benzenesulfonyl)pyrrolidin-2-yl]-2-methylpyrimidin-4-amine (PubChem CID 110091079) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is 6-[1-(benzenesulfonyl)pyrrolidin-2-yl]-2-methylpyrimidin-4-amine.
| Compound Name | 6-[1-(benzenesulfonyl)pyrrolidin-2-yl]-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 110091079 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 6-[1-(benzenesulfonyl)pyrrolidin-2-yl]-2-methylpyrimidin-4-amine |
| SMILES | Cc1nc(N)cc(C2CCCN2S(=O)(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C15H18N4O2S/c1-11-17-13(10-15(16)18-11)14-8-5-9-19(14)22(20,21)12-6-3-2-4-7-12/h2-4,6-7,10,14H,5,8-9H2,1H3,(H2,16,17,18) |
| InChIKey | JZUMDYAUXSSDOS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |