C18H26FN3O2 — CID 124983310
N-[[(3S)-1-(5-fluoro-2-pyridinyl)-3-hydroxypiperidin-3-yl]methyl]cyclohexanecarboxamide (PubChem CID 124983310) has the molecular formula C18H26FN3O2 and a molecular weight of 335.42 g/mol. Its IUPAC name is N-[[(3S)-1-(5-fluoro-2-pyridinyl)-3-hydroxypiperidin-3-yl]methyl]cyclohexanecarboxamide.
| Compound Name | N-[[(3S)-1-(5-fluoro-2-pyridinyl)-3-hydroxypiperidin-3-yl]methyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 124983310 |
| Molecular Formula | C18H26FN3O2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N-[[(3S)-1-(5-fluoro-2-pyridinyl)-3-hydroxypiperidin-3-yl]methyl]cyclohexanecarboxamide |
| SMILES | O=C(NC[C@@]1(O)CCCN(c2ccc(F)cn2)C1)C1CCCCC1 |
| InChI | InChI=1S/C18H26FN3O2/c19-15-7-8-16(20-11-15)22-10-4-9-18(24,13-22)12-21-17(23)14-5-2-1-3-6-14/h7-8,11,14,24H,1-6,9-10,12-13H2,(H,21,23)/t18-/m0/s1 |
| InChIKey | NCVURSLUGPRCHE-SFHVURJKSA-N |
| XLogP | 2.25 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |