C11H16FN3O3S — CID 125024514
N-[[(3S)-1-(5-fluoro-2-pyridinyl)-3-hydroxypyrrolidin-3-yl]methyl]methanesulfonamide (PubChem CID 125024514) has the molecular formula C11H16FN3O3S and a molecular weight of 289.33 g/mol. Its IUPAC name is N-[[(3S)-1-(5-fluoro-2-pyridinyl)-3-hydroxypyrrolidin-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(3S)-1-(5-fluoro-2-pyridinyl)-3-hydroxypyrrolidin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 125024514 |
| Molecular Formula | C11H16FN3O3S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-[[(3S)-1-(5-fluoro-2-pyridinyl)-3-hydroxypyrrolidin-3-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@]1(O)CCN(c2ccc(F)cn2)C1 |
| InChI | InChI=1S/C11H16FN3O3S/c1-19(17,18)14-7-11(16)4-5-15(8-11)10-3-2-9(12)6-13-10/h2-3,6,14,16H,4-5,7-8H2,1H3/t11-/m1/s1 |
| InChIKey | ZGEZEWDTBWIGJA-LLVKDONJSA-N |
| XLogP | -0.29 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |