C18H26FNO2 — CID 124983316
(3R)-3-[(4-fluorophenyl)methyl]-8-(2-methoxyethyl)-2-oxa-8-azaspiro[4.5]decane (PubChem CID 124983316) has the molecular formula C18H26FNO2 and a molecular weight of 307.41 g/mol. Its IUPAC name is (3R)-3-[(4-fluorophenyl)methyl]-8-(2-methoxyethyl)-2-oxa-8-azaspiro[4.5]decane.
| Compound Name | (3R)-3-[(4-fluorophenyl)methyl]-8-(2-methoxyethyl)-2-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 124983316 |
| Molecular Formula | C18H26FNO2 |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (3R)-3-[(4-fluorophenyl)methyl]-8-(2-methoxyethyl)-2-oxa-8-azaspiro[4.5]decane |
| SMILES | COCCN1CCC2(CC1)CO[C@H](Cc1ccc(F)cc1)C2 |
| InChI | InChI=1S/C18H26FNO2/c1-21-11-10-20-8-6-18(7-9-20)13-17(22-14-18)12-15-2-4-16(19)5-3-15/h2-5,17H,6-14H2,1H3/t17-/m1/s1 |
| InChIKey | NCWSYPVYBODKBF-QGZVFWFLSA-N |
| XLogP | 2.89 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |